About 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one
2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one (PubChem CID 72744175) has the molecular formula C8H6N4OS2
and a molecular weight of 238.30 g/mol. Its IUPAC name is 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one.
Molecular Properties
| Compound Name | 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one |
| PubChem CID | 72744175 |
| Molecular Formula | C8H6N4OS2 |
| Molecular Weight | 238.30 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one |
| SMILES | O=c1c2c(nc3n1CCCS3)=NC(=S)N=2 |
| InChI | InChI=1S/C8H6N4OS2/c13-6-4-5(10-7(14)9-4)11-8-12(6)2-1-3-15-8/h1-3H2 |
| InChIKey | MKCNVBIUASTREH-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.30 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one?
The IUPAC name of 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one (CID 72744175) is 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one.
What is the SMILES notation for 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one?
The canonical SMILES for 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one is O=c1c2c(nc3n1CCCS3)=NC(=S)N=2.
What is the InChIKey of 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one?
The InChIKey is MKCNVBIUASTREH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N4OS2/c13-6-4-5(10-7(14)9-4)11-8-12(6)2-1-3-15-8/h1-3H2.
What are the key properties of 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one?
2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one has a molecular weight of 238.30 g/mol, XLogP of -0.72, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylidene-7,8-dihydro-6H-[1,3]thiazino[3,2-a]purin-10-one is sourced from PubChem (CID 72744175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).