C20H28O13 — CID 72745211
methyl 2,4-diacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate (PubChem CID 72745211) has the molecular formula C20H28O13 and a molecular weight of 476.43 g/mol. Its IUPAC name is methyl 2,4-diacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate.
| Compound Name | methyl 2,4-diacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 72745211 |
| Molecular Formula | C20H28O13 |
| Molecular Weight | 476.43 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | methyl 2,4-diacetyloxy-6-(1,2,3-triacetyloxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(OC(C)=O)CC(OC(C)=O)CC(C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C20H28O13/c1-10(21)28-9-17(30-12(3)23)18(31-13(4)24)16-7-15(29-11(2)22)8-20(33-16,19(26)27-6)32-14(5)25/h15-18H,7-9H2,1-6H3 |
| InChIKey | HNKKNHLCOFFWBY-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.43 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|