C25H33ClN2O2 — CID 72748836
1-[2-(3-aminopyrrolidin-1-yl)-1-(3-chloro-4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol (PubChem CID 72748836) has the molecular formula C25H33ClN2O2 and a molecular weight of 429.00 g/mol. Its IUPAC name is 1-[2-(3-aminopyrrolidin-1-yl)-1-(3-chloro-4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol.
| Compound Name | 1-[2-(3-aminopyrrolidin-1-yl)-1-(3-chloro-4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72748836 |
| Molecular Formula | C25H33ClN2O2 |
| Molecular Weight | 429.00 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[2-(3-aminopyrrolidin-1-yl)-1-(3-chloro-4-phenylmethoxyphenyl)ethyl]cyclohexan-1-ol |
| SMILES | NC1CCN(CC(c2ccc(OCc3ccccc3)c(Cl)c2)C2(O)CCCCC2)C1 |
| InChI | InChI=1S/C25H33ClN2O2/c26-23-15-20(9-10-24(23)30-18-19-7-3-1-4-8-19)22(17-28-14-11-21(27)16-28)25(29)12-5-2-6-13-25/h1,3-4,7-10,15,21-22,29H,2,5-6,11-14,16-18,27H2 |
| InChIKey | XHVULMOUPAEUNC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |