About (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate
(4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate (PubChem CID 72751417) has the molecular formula C13H18O7
and a molecular weight of 286.28 g/mol. Its IUPAC name is (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate.
Molecular Properties
| Compound Name | (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate |
| PubChem CID | 72751417 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate |
| SMILES | CC=CC(O)C(O)C=CC(=O)OCC1COC(=O)C1O |
| InChI | InChI=1S/C13H18O7/c1-2-3-9(14)10(15)4-5-11(16)19-6-8-7-20-13(18)12(8)17/h2-5,8-10,12,14-15,17H,6-7H2,1H3 |
| InChIKey | JHQCSIROSIRYBV-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate?
The IUPAC name of (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate (CID 72751417) is (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate.
What is the SMILES notation for (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate?
The canonical SMILES for (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate is CC=CC(O)C(O)C=CC(=O)OCC1COC(=O)C1O.
What is the InChIKey of (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate?
The InChIKey is JHQCSIROSIRYBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O7/c1-2-3-9(14)10(15)4-5-11(16)19-6-8-7-20-13(18)12(8)17/h2-5,8-10,12,14-15,17H,6-7H2,1H3.
What are the key properties of (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate?
(4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate has a molecular weight of 286.28 g/mol, XLogP of -1.08, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-5-oxooxolan-3-yl)methyl 4,5-dihydroxyocta-2,6-dienoate is sourced from PubChem (CID 72751417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).