6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid

C13H23NO7 — CID 72756610

IUPAC6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid
SMILESCCCN(CCC)C(=O)C1OC(O)(C(=O)O)CC(O)C1O
InChIInChI=1S/C13H23NO7/c1-3-5-14(6-4-2)11(17)10-9(16)8(15)7-13(20,21-10)12(18)19/h8-10,15-16,20H,3-7H2,1-2H3,(H,18,19)
InChIKeyYOLAUIMRJUSMCJ-UHFFFAOYSA-N
MW305.33 g/mol
LogP-1.08
Rot. Bonds6

About 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid

6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 72756610) has the molecular formula C13H23NO7 and a molecular weight of 305.33 g/mol. Its IUPAC name is 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid.

Molecular Properties

Compound Name6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid
PubChem CID72756610
Molecular FormulaC13H23NO7
Molecular Weight305.33 g/mol
Exact Mass305.15
IUPAC Name6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid
SMILESCCCN(CCC)C(=O)C1OC(O)(C(=O)O)CC(O)C1O
InChIInChI=1S/C13H23NO7/c1-3-5-14(6-4-2)11(17)10-9(16)8(15)7-13(20,21-10)12(18)19/h8-10,15-16,20H,3-7H2,1-2H3,(H,18,19)
InChIKeyYOLAUIMRJUSMCJ-UHFFFAOYSA-N
XLogP-1.08
TPSA127.53 Ų
H-Bond Donors4
H-Bond Acceptors6
Rotatable Bonds6
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.33
LogP ≤ 5-1.08
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 106

Analyze 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid?
The IUPAC name of 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid (CID 72756610) is 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid.
What is the SMILES notation for 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid?
The canonical SMILES for 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid is CCCN(CCC)C(=O)C1OC(O)(C(=O)O)CC(O)C1O.
What is the InChIKey of 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid?
The InChIKey is YOLAUIMRJUSMCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO7/c1-3-5-14(6-4-2)11(17)10-9(16)8(15)7-13(20,21-10)12(18)19/h8-10,15-16,20H,3-7H2,1-2H3,(H,18,19).
What are the key properties of 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid?
6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid has a molecular weight of 305.33 g/mol, XLogP of -1.08, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(dipropylcarbamoyl)-2,4,5-trihydroxyoxane-2-carboxylic acid is sourced from PubChem (CID 72756610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).