C21H18F2O3 — CID 72757230
6,7-bis(4-fluorophenyl)-4,4-dimethyl-3a,7a-dihydro-3H-furo[3,4-c]pyran-1-one (PubChem CID 72757230) has the molecular formula C21H18F2O3 and a molecular weight of 356.37 g/mol. Its IUPAC name is 6,7-bis(4-fluorophenyl)-4,4-dimethyl-3a,7a-dihydro-3H-furo[3,4-c]pyran-1-one.
| Compound Name | 6,7-bis(4-fluorophenyl)-4,4-dimethyl-3a,7a-dihydro-3H-furo[3,4-c]pyran-1-one |
|---|---|
| PubChem CID | 72757230 |
| Molecular Formula | C21H18F2O3 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 6,7-bis(4-fluorophenyl)-4,4-dimethyl-3a,7a-dihydro-3H-furo[3,4-c]pyran-1-one |
| SMILES | CC1(C)OC(c2ccc(F)cc2)=C(c2ccc(F)cc2)C2C(=O)OCC21 |
| InChI | InChI=1S/C21H18F2O3/c1-21(2)16-11-25-20(24)18(16)17(12-3-7-14(22)8-4-12)19(26-21)13-5-9-15(23)10-6-13/h3-10,16,18H,11H2,1-2H3 |
| InChIKey | OGYIAKLAUSOEGP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|