About (4-chloro-2-methylphenyl) 3-bromobenzoate
(4-chloro-2-methylphenyl) 3-bromobenzoate (PubChem CID 727614) has the molecular formula C14H10BrClO2
and a molecular weight of 325.59 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 3-bromobenzoate.
Molecular Properties
| Compound Name | (4-chloro-2-methylphenyl) 3-bromobenzoate |
| PubChem CID | 727614 |
| Molecular Formula | C14H10BrClO2 |
| Molecular Weight | 325.59 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | (4-chloro-2-methylphenyl) 3-bromobenzoate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H10BrClO2/c1-9-7-12(16)5-6-13(9)18-14(17)10-3-2-4-11(15)8-10/h2-8H,1H3 |
| InChIKey | OGZJHMOIOSTWSX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-chloro-2-methylphenyl) 3-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-chloro-2-methylphenyl) 3-bromobenzoate?
The IUPAC name of (4-chloro-2-methylphenyl) 3-bromobenzoate (CID 727614) is (4-chloro-2-methylphenyl) 3-bromobenzoate.
What is the SMILES notation for (4-chloro-2-methylphenyl) 3-bromobenzoate?
The canonical SMILES for (4-chloro-2-methylphenyl) 3-bromobenzoate is Cc1cc(Cl)ccc1OC(=O)c1cccc(Br)c1.
What is the InChIKey of (4-chloro-2-methylphenyl) 3-bromobenzoate?
The InChIKey is OGZJHMOIOSTWSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrClO2/c1-9-7-12(16)5-6-13(9)18-14(17)10-3-2-4-11(15)8-10/h2-8H,1H3.
What are the key properties of (4-chloro-2-methylphenyl) 3-bromobenzoate?
(4-chloro-2-methylphenyl) 3-bromobenzoate has a molecular weight of 325.59 g/mol, XLogP of 4.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-chloro-2-methylphenyl) 3-bromobenzoate is sourced from PubChem (CID 727614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).