C26H38FNO7 — CID 72763537
3-[1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 72763537) has the molecular formula C26H38FNO7 and a molecular weight of 495.59 g/mol. Its IUPAC name is 3-[1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | 3-[1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 72763537 |
| Molecular Formula | C26H38FNO7 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 3-[1-fluoro-2-(2-methyl-1,3-oxazol-4-yl)ethenyl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | Cc1nc(C=C(F)C2CC3OC3(C)CCCC(C)C(O)C(C)C(=O)C(C)(C)C(O)CC(=O)O2)co1 |
| InChI | InChI=1S/C26H38FNO7/c1-14-8-7-9-26(6)21(35-26)11-19(18(27)10-17-13-33-16(3)28-17)34-22(30)12-20(29)25(4,5)24(32)15(2)23(14)31/h10,13-15,19-21,23,29,31H,7-9,11-12H2,1-6H3 |
| InChIKey | OVHMPAINMJZKPU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|