About 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate
3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate (PubChem CID 7276393) has the molecular formula C7H11N2O2-
and a molecular weight of 155.18 g/mol. Its IUPAC name is 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate.
Molecular Properties
| Compound Name | 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate |
| PubChem CID | 7276393 |
| Molecular Formula | C7H11N2O2- |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate |
| SMILES | CC1=NN(CCC(=O)[O-])CC1 |
| InChI | InChI=1S/C7H12N2O2/c1-6-2-4-9(8-6)5-3-7(10)11/h2-5H2,1H3,(H,10,11)/p-1 |
| InChIKey | OMGIZEDLXGDIKX-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate?
The IUPAC name of 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate (CID 7276393) is 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate.
What is the SMILES notation for 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate?
The canonical SMILES for 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate is CC1=NN(CCC(=O)[O-])CC1.
What is the InChIKey of 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate?
The InChIKey is OMGIZEDLXGDIKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H12N2O2/c1-6-2-4-9(8-6)5-3-7(10)11/h2-5H2,1H3,(H,10,11)/p-1.
What are the key properties of 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate?
3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate has a molecular weight of 155.18 g/mol, XLogP of -0.79, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-3,4-dihydropyrazol-2-yl)propanoate is sourced from PubChem (CID 7276393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).