C18H29NO — CID 72766119
N-[6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dien-2-ylidene]hydroxylamine (PubChem CID 72766119) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is N-[6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dien-2-ylidene]hydroxylamine.
| Compound Name | N-[6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dien-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 72766119 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | N-[6-methyl-8-(2,6,6-trimethylcyclohexen-1-yl)octa-3,5-dien-2-ylidene]hydroxylamine |
| SMILES | CC(=CC=CC(C)=NO)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H29NO/c1-14(8-6-10-16(3)19-20)11-12-17-15(2)9-7-13-18(17,4)5/h6,8,10,20H,7,9,11-13H2,1-5H3 |
| InChIKey | BJFYQWABTQWNNI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|