C29H21F3N2O5S — CID 72769032
5-[1-[4-[2-[2-(3,4-difluorophenyl)-7-fluoro-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 72769032) has the molecular formula C29H21F3N2O5S and a molecular weight of 566.56 g/mol. Its IUPAC name is 5-[1-[4-[2-[2-(3,4-difluorophenyl)-7-fluoro-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[1-[4-[2-[2-(3,4-difluorophenyl)-7-fluoro-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 72769032 |
| Molecular Formula | C29H21F3N2O5S |
| Molecular Weight | 566.56 g/mol |
| Exact Mass | 566.11 |
| IUPAC Name | 5-[1-[4-[2-[2-(3,4-difluorophenyl)-7-fluoro-1-methyl-4-oxoquinolin-3-yl]oxyethoxy]phenyl]ethylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(=C1SC(=O)NC1=O)c1ccc(OCCOc2c(-c3ccc(F)c(F)c3)n(C)c3cc(F)ccc3c2=O)cc1 |
| InChI | InChI=1S/C29H21F3N2O5S/c1-15(27-28(36)33-29(37)40-27)16-3-7-19(8-4-16)38-11-12-39-26-24(17-5-10-21(31)22(32)13-17)34(2)23-14-18(30)6-9-20(23)25(26)35/h3-10,13-14H,11-12H2,1-2H3,(H,33,36,37) |
| InChIKey | LSEQKOKAYOBTNH-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|