C22H24Br4O8 — CID 72769711
1-[9-(1-acetyloxybutyl)-1,10,11,12-tetrabromo-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-2-yl]butyl acetate (PubChem CID 72769711) has the molecular formula C22H24Br4O8 and a molecular weight of 736.04 g/mol. Its IUPAC name is 1-[9-(1-acetyloxybutyl)-1,10,11,12-tetrabromo-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-2-yl]butyl acetate.
| Compound Name | 1-[9-(1-acetyloxybutyl)-1,10,11,12-tetrabromo-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-2-yl]butyl acetate |
|---|---|
| PubChem CID | 72769711 |
| Molecular Formula | C22H24Br4O8 |
| Molecular Weight | 736.04 g/mol |
| Exact Mass | 731.82 |
| IUPAC Name | 1-[9-(1-acetyloxybutyl)-1,10,11,12-tetrabromo-3,8-dioxo-4,7-dioxadispiro[4.0.46.25]dodeca-1,9-dien-2-yl]butyl acetate |
| SMILES | CCCC(OC(C)=O)C1=C(Br)C2(OC1=O)C(Br)C(Br)C21OC(=O)C(C(CCC)OC(C)=O)=C1Br |
| InChI | InChI=1S/C22H24Br4O8/c1-5-7-11(31-9(3)27)13-15(23)21(33-19(13)29)17(25)18(26)22(21)16(24)14(20(30)34-22)12(8-6-2)32-10(4)28/h11-12,17-18H,5-8H2,1-4H3 |
| InChIKey | KTVHZSRPYOOBAY-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.04 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|