About 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate
3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate (PubChem CID 72770437) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate.
Molecular Properties
| Compound Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate |
| PubChem CID | 72770437 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate |
| SMILES | CC(=O)OCC=CC1COC(C)(C)O1 |
| InChI | InChI=1S/C10H16O4/c1-8(11)12-6-4-5-9-7-13-10(2,3)14-9/h4-5,9H,6-7H2,1-3H3 |
| InChIKey | DDBBNQPBZLVQHR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate?
The IUPAC name of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate (CID 72770437) is 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate.
What is the SMILES notation for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate?
The canonical SMILES for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate is CC(=O)OCC=CC1COC(C)(C)O1.
What is the InChIKey of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate?
The InChIKey is DDBBNQPBZLVQHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-8(11)12-6-4-5-9-7-13-10(2,3)14-9/h4-5,9H,6-7H2,1-3H3.
What are the key properties of 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate?
3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate has a molecular weight of 200.23 g/mol, XLogP of 1.26, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethyl-1,3-dioxolan-4-yl)prop-2-enyl acetate is sourced from PubChem (CID 72770437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).