C14H9BF5NO2 — CID 72771040
difluoro-(2-phenylfuro[3,2-b]pyridin-4-ium-4-yl)oxy-(trifluoromethyl)boranuide (PubChem CID 72771040) has the molecular formula C14H9BF5NO2 and a molecular weight of 329.03 g/mol. Its IUPAC name is difluoro-(2-phenylfuro[3,2-b]pyridin-4-ium-4-yl)oxy-(trifluoromethyl)boranuide.
| Compound Name | difluoro-(2-phenylfuro[3,2-b]pyridin-4-ium-4-yl)oxy-(trifluoromethyl)boranuide |
|---|---|
| PubChem CID | 72771040 |
| Molecular Formula | C14H9BF5NO2 |
| Molecular Weight | 329.03 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | difluoro-(2-phenylfuro[3,2-b]pyridin-4-ium-4-yl)oxy-(trifluoromethyl)boranuide |
| SMILES | F[B-](F)(O[n+]1cccc2oc(-c3ccccc3)cc21)C(F)(F)F |
| InChI | InChI=1S/C14H9BF5NO2/c16-14(17,18)15(19,20)23-21-8-4-7-12-11(21)9-13(22-12)10-5-2-1-3-6-10/h1-9H |
| InChIKey | RDKODUJTOKSMRR-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.03 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|