C26H26N6O3 — CID 72771091
2-[[(1S)-2-[(1R,2S)-2-(2H-tetrazol-5-yl)cyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 72771091) has the molecular formula C26H26N6O3 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[[(1S)-2-[(1R,2S)-2-(2H-tetrazol-5-yl)cyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S)-2-[(1R,2S)-2-(2H-tetrazol-5-yl)cyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 72771091 |
| Molecular Formula | C26H26N6O3 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 2-[[(1S)-2-[(1R,2S)-2-(2H-tetrazol-5-yl)cyclohexanecarbonyl]-3,4-dihydro-1H-isoquinolin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@@H]1c2ccccc2CCN1C(=O)[C@@H]1CCCC[C@@H]1c1nn[nH]n1 |
| InChI | InChI=1S/C26H26N6O3/c33-24(19-10-4-3-9-18(19)23-27-29-30-28-23)31-14-13-16-7-1-2-8-17(16)22(31)15-32-25(34)20-11-5-6-12-21(20)26(32)35/h1-2,5-8,11-12,18-19,22H,3-4,9-10,13-15H2,(H,27,28,29,30)/t18-,19+,22+/m0/s1 |
| InChIKey | ADUCXORFAZLUAN-NNMXDRDESA-N |
| XLogP | 2.90 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|