C24H28O6S — CID 72773025
(6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl) acetate (PubChem CID 72773025) has the molecular formula C24H28O6S and a molecular weight of 444.55 g/mol. Its IUPAC name is (6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl) acetate.
| Compound Name | (6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl) acetate |
|---|---|
| PubChem CID | 72773025 |
| Molecular Formula | C24H28O6S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (6-ethylsulfanyl-2-phenyl-8-phenylmethoxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl) acetate |
| SMILES | CCSC1OC2COC(c3ccccc3)OC2C(OCc2ccccc2)C1OC(C)=O |
| InChI | InChI=1S/C24H28O6S/c1-3-31-24-22(28-16(2)25)21(26-14-17-10-6-4-7-11-17)20-19(29-24)15-27-23(30-20)18-12-8-5-9-13-18/h4-13,19-24H,3,14-15H2,1-2H3 |
| InChIKey | WREZGOLGUDWSGX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |