C29H37NO6 — CID 72773480
N-[(3,11-dimethyl-19-methylidene-7,13-dioxo-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-5-yl)-hydroxymethyl]hexa-2,4-dienamide (PubChem CID 72773480) has the molecular formula C29H37NO6 and a molecular weight of 495.62 g/mol. Its IUPAC name is N-[(3,11-dimethyl-19-methylidene-7,13-dioxo-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-5-yl)-hydroxymethyl]hexa-2,4-dienamide.
| Compound Name | N-[(3,11-dimethyl-19-methylidene-7,13-dioxo-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-5-yl)-hydroxymethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 72773480 |
| Molecular Formula | C29H37NO6 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | N-[(3,11-dimethyl-19-methylidene-7,13-dioxo-6,21-dioxabicyclo[15.3.1]henicosa-2,8,10,14-tetraen-5-yl)-hydroxymethyl]hexa-2,4-dienamide |
| SMILES | C=C1CC2C=C(C)CC(C(O)NC(=O)C=CC=CC)OC(=O)C=CC=C(C)CC(=O)C=CCC(C1)O2 |
| InChI | InChI=1S/C29H37NO6/c1-5-6-7-13-27(32)30-29(34)26-19-22(4)18-25-17-21(3)16-24(35-25)12-9-11-23(31)15-20(2)10-8-14-28(33)36-26/h5-11,13-14,18,24-26,29,34H,3,12,15-17,19H2,1-2,4H3,(H,30,32) |
| InChIKey | NJZJMJVVSZTAGX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|