C13H15NO2S — CID 727736
propan-2-yl (Z)-2-cyano-3-(2,5-dimethylthiophen-3-yl)prop-2-enoate (PubChem CID 727736) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is propan-2-yl (Z)-2-cyano-3-(2,5-dimethylthiophen-3-yl)prop-2-enoate.
| Compound Name | propan-2-yl (Z)-2-cyano-3-(2,5-dimethylthiophen-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 727736 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | propan-2-yl (Z)-2-cyano-3-(2,5-dimethylthiophen-3-yl)prop-2-enoate |
| SMILES | Cc1cc(/C=C(/C#N)C(=O)OC(C)C)c(C)s1 |
| InChI | InChI=1S/C13H15NO2S/c1-8(2)16-13(15)12(7-14)6-11-5-9(3)17-10(11)4/h5-6,8H,1-4H3/b12-6- |
| InChIKey | RRTYVGQZYIVZEX-SDQBBNPISA-N |
| XLogP | 3.22 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|