C13H7ClO3S — CID 727741
7-(3-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one (PubChem CID 727741) has the molecular formula C13H7ClO3S and a molecular weight of 278.72 g/mol. Its IUPAC name is 7-(3-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one.
| Compound Name | 7-(3-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 727741 |
| Molecular Formula | C13H7ClO3S |
| Molecular Weight | 278.72 g/mol |
| Exact Mass | 277.98 |
| IUPAC Name | 7-(3-chlorophenyl)-5-hydroxy-1,3-benzoxathiol-2-one |
| SMILES | O=c1oc2c(-c3cccc(Cl)c3)cc(O)cc2s1 |
| InChI | InChI=1S/C13H7ClO3S/c14-8-3-1-2-7(4-8)10-5-9(15)6-11-12(10)17-13(16)18-11/h1-6,15H |
| InChIKey | VPTFYMNILPYFRK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.72 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'} |
|---|