C44H40Cl3NO8 — CID 72774777
[3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate (PubChem CID 72774777) has the molecular formula C44H40Cl3NO8 and a molecular weight of 817.16 g/mol. Its IUPAC name is [3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate.
| Compound Name | [3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 72774777 |
| Molecular Formula | C44H40Cl3NO8 |
| Molecular Weight | 817.16 g/mol |
| Exact Mass | 815.18 |
| IUPAC Name | [3-(9H-fluoren-9-ylmethoxycarbonyloxy)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl] 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OC(=O)OCC1c2ccccc2-c2ccccc21)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C44H40Cl3NO8/c45-44(46,47)42(48)56-41-40(55-43(49)53-27-36-34-22-12-10-20-32(34)33-21-11-13-23-35(33)36)39(52-26-31-18-8-3-9-19-31)38(51-25-30-16-6-2-7-17-30)37(54-41)28-50-24-29-14-4-1-5-15-29/h1-23,36-41,48H,24-28H2/b48-42+ |
| InChIKey | VRTFSGMPNZVQON-ARYAGILTSA-N |
| XLogP | 9.80 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.16 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|