About 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one
3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one (PubChem CID 72775190) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one.
Analyze 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one?
The IUPAC name of 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one (CID 72775190) is 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one.
What is the SMILES notation for 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one?
The canonical SMILES for 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one is O=C1CC2OCCCCC2O1.
What is the InChIKey of 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one?
The InChIKey is DULFKDKRFITSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c9-8-5-7-6(11-8)3-1-2-4-10-7/h6-7H,1-5H2.
What are the key properties of 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one?
3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one has a molecular weight of 156.18 g/mol, XLogP of 0.87, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,5,6,7,8,8a-hexahydro-3H-furo[3,2-b]oxepin-2-one is sourced from PubChem (CID 72775190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).