C18H13F5N2O2 — CID 7277593
(4S)-2-amino-7,7-dimethyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-4H-chromene-3-carbonitrile (PubChem CID 7277593) has the molecular formula C18H13F5N2O2 and a molecular weight of 384.30 g/mol. Its IUPAC name is (4S)-2-amino-7,7-dimethyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-4H-chromene-3-carbonitrile.
| Compound Name | (4S)-2-amino-7,7-dimethyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-4H-chromene-3-carbonitrile |
|---|---|
| PubChem CID | 7277593 |
| Molecular Formula | C18H13F5N2O2 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | (4S)-2-amino-7,7-dimethyl-5-oxo-4-(2,3,4,5,6-pentafluorophenyl)-6,8-dihydro-4H-chromene-3-carbonitrile |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(N)=C(C#N)[C@@H]2c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H13F5N2O2/c1-18(2)3-7(26)10-8(4-18)27-17(25)6(5-24)9(10)11-12(19)14(21)16(23)15(22)13(11)20/h9H,3-4,25H2,1-2H3/t9-/m0/s1 |
| InChIKey | UDDHAEIGVNZGRQ-VIFPVBQESA-N |
| XLogP | 3.83 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|