C25H21N3O6 — CID 72777896
ethyl 3-(4-nitrophenyl)-2'-oxo-2-phenylspiro[1,2-oxazolidine-4,3'-1H-indole]-5-carboxylate (PubChem CID 72777896) has the molecular formula C25H21N3O6 and a molecular weight of 459.46 g/mol. Its IUPAC name is ethyl 3-(4-nitrophenyl)-2'-oxo-2-phenylspiro[1,2-oxazolidine-4,3'-1H-indole]-5-carboxylate.
| Compound Name | ethyl 3-(4-nitrophenyl)-2'-oxo-2-phenylspiro[1,2-oxazolidine-4,3'-1H-indole]-5-carboxylate |
|---|---|
| PubChem CID | 72777896 |
| Molecular Formula | C25H21N3O6 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | ethyl 3-(4-nitrophenyl)-2'-oxo-2-phenylspiro[1,2-oxazolidine-4,3'-1H-indole]-5-carboxylate |
| SMILES | CCOC(=O)C1ON(c2ccccc2)C(c2ccc([N+](=O)[O-])cc2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C25H21N3O6/c1-2-33-23(29)22-25(19-10-6-7-11-20(19)26-24(25)30)21(16-12-14-18(15-13-16)28(31)32)27(34-22)17-8-4-3-5-9-17/h3-15,21-22H,2H2,1H3,(H,26,30) |
| InChIKey | PTFRBCBIJXGCCE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|