C13H5Cl5FNO2 — CID 7277844
(2-chloro-6-fluorophenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate (PubChem CID 7277844) has the molecular formula C13H5Cl5FNO2 and a molecular weight of 403.45 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate |
|---|---|
| PubChem CID | 7277844 |
| Molecular Formula | C13H5Cl5FNO2 |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 400.87 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl 3,4,5,6-tetrachloropyridine-2-carboxylate |
| SMILES | O=C(OCc1c(F)cccc1Cl)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl5FNO2/c14-6-2-1-3-7(19)5(6)4-22-13(21)11-9(16)8(15)10(17)12(18)20-11/h1-3H,4H2 |
| InChIKey | RPCZVDGMOQXJGM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|