C33H48N2O7 — CID 72778856
[12,13-dihydroxy-4-methyl-2-[4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,14,18-tetraen-11-yl] carbamate (PubChem CID 72778856) has the molecular formula C33H48N2O7 and a molecular weight of 584.75 g/mol. Its IUPAC name is [12,13-dihydroxy-4-methyl-2-[4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,14,18-tetraen-11-yl] carbamate.
| Compound Name | [12,13-dihydroxy-4-methyl-2-[4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,14,18-tetraen-11-yl] carbamate |
|---|---|
| PubChem CID | 72778856 |
| Molecular Formula | C33H48N2O7 |
| Molecular Weight | 584.75 g/mol |
| Exact Mass | 584.35 |
| IUPAC Name | [12,13-dihydroxy-4-methyl-2-[4-methyl-6-(3-methylbut-2-enoylamino)hexa-3,5-dien-2-yl]-20-oxo-1-oxacycloicosa-4,6,14,18-tetraen-11-yl] carbamate |
| SMILES | CC(C)=CC(=O)NC=CC(C)=CC(C)C1CC(C)=CC=CCCCC(OC(N)=O)C(O)C(O)C=CCCC=CC(=O)O1 |
| InChI | InChI=1S/C33H48N2O7/c1-23(2)20-30(37)35-19-18-25(4)21-26(5)29-22-24(3)14-10-6-8-12-16-28(42-33(34)40)32(39)27(36)15-11-7-9-13-17-31(38)41-29/h6,10-11,13-15,17-21,26-29,32,36,39H,7-9,12,16,22H2,1-5H3,(H2,34,40)(H,35,37) |
| InChIKey | BMKCISMFGDXUPH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.75 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|