C16H20N2O2 — CID 72780652
1-benzyl-2-but-2-enoyl-5,5-dimethylpyrazolidin-3-one (PubChem CID 72780652) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-benzyl-2-but-2-enoyl-5,5-dimethylpyrazolidin-3-one.
| Compound Name | 1-benzyl-2-but-2-enoyl-5,5-dimethylpyrazolidin-3-one |
|---|---|
| PubChem CID | 72780652 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-benzyl-2-but-2-enoyl-5,5-dimethylpyrazolidin-3-one |
| SMILES | CC=CC(=O)N1C(=O)CC(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C16H20N2O2/c1-4-8-14(19)18-15(20)11-16(2,3)17(18)12-13-9-6-5-7-10-13/h4-10H,11-12H2,1-3H3 |
| InChIKey | JMBNKBRBSBFTDF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|