C12H20O10 — CID 72781233
5,8,14,16-tetraoxadispiro[5.2.59.26]hexadecane-1,2,3,10,11,12-hexol (PubChem CID 72781233) has the molecular formula C12H20O10 and a molecular weight of 324.28 g/mol. Its IUPAC name is 5,8,14,16-tetraoxadispiro[5.2.59.26]hexadecane-1,2,3,10,11,12-hexol.
| Compound Name | 5,8,14,16-tetraoxadispiro[5.2.59.26]hexadecane-1,2,3,10,11,12-hexol |
|---|---|
| PubChem CID | 72781233 |
| Molecular Formula | C12H20O10 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5,8,14,16-tetraoxadispiro[5.2.59.26]hexadecane-1,2,3,10,11,12-hexol |
| SMILES | OC1COC2(COC3(CO2)OCC(O)C(O)C3O)C(O)C1O |
| InChI | InChI=1S/C12H20O10/c13-5-1-19-11(9(17)7(5)15)3-22-12(4-21-11)10(18)8(16)6(14)2-20-12/h5-10,13-18H,1-4H2 |
| InChIKey | LTUQKHKMVTWQIX-UHFFFAOYSA-N |
| XLogP | -4.35 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -4.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |