C8H4F12O — CID 72781455
3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-en-1-ol (PubChem CID 72781455) has the molecular formula C8H4F12O and a molecular weight of 344.10 g/mol. Its IUPAC name is 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-en-1-ol.
| Compound Name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-en-1-ol |
|---|---|
| PubChem CID | 72781455 |
| Molecular Formula | C8H4F12O |
| Molecular Weight | 344.10 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 3,4,4,5,5,6,6,7,7,8,8,8-dodecafluorooct-2-en-1-ol |
| SMILES | OCC=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O/c9-3(1-2-21)4(10,11)5(12,13)6(14,15)7(16,17)8(18,19)20/h1,21H,2H2 |
| InChIKey | RIRNSDSPUYRGOI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.10 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|