About 4-(furan-2-yl)-1,3-thiazol-2-amine
4-(furan-2-yl)-1,3-thiazol-2-amine (PubChem CID 727834) has the molecular formula C7H6N2OS
and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-(furan-2-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(furan-2-yl)-1,3-thiazol-2-amine |
| PubChem CID | 727834 |
| Molecular Formula | C7H6N2OS |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 4-(furan-2-yl)-1,3-thiazol-2-amine |
| SMILES | Nc1nc(-c2ccco2)cs1 |
| InChI | InChI=1S/C7H6N2OS/c8-7-9-5(4-11-7)6-2-1-3-10-6/h1-4H,(H2,8,9) |
| InChIKey | CGJGALUSBPYALD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(furan-2-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(furan-2-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(furan-2-yl)-1,3-thiazol-2-amine (CID 727834) is 4-(furan-2-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(furan-2-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(furan-2-yl)-1,3-thiazol-2-amine is Nc1nc(-c2ccco2)cs1.
What is the InChIKey of 4-(furan-2-yl)-1,3-thiazol-2-amine?
The InChIKey is CGJGALUSBPYALD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2OS/c8-7-9-5(4-11-7)6-2-1-3-10-6/h1-4H,(H2,8,9).
What are the key properties of 4-(furan-2-yl)-1,3-thiazol-2-amine?
4-(furan-2-yl)-1,3-thiazol-2-amine has a molecular weight of 166.20 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(furan-2-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 727834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).