C17H21NO3 — CID 72785526
4-azatetracyclo[11.5.0.02,6.07,12]octadec-12-ene-3,5,16-trione (PubChem CID 72785526) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-azatetracyclo[11.5.0.02,6.07,12]octadec-12-ene-3,5,16-trione.
| Compound Name | 4-azatetracyclo[11.5.0.02,6.07,12]octadec-12-ene-3,5,16-trione |
|---|---|
| PubChem CID | 72785526 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-azatetracyclo[11.5.0.02,6.07,12]octadec-12-ene-3,5,16-trione |
| SMILES | O=C1CCC2=C3CCCCC3C3C(=O)NC(=O)C3C2CC1 |
| InChI | InChI=1S/C17H21NO3/c19-9-5-7-11-10-3-1-2-4-12(10)14-15(13(11)8-6-9)17(21)18-16(14)20/h12-15H,1-8H2,(H,18,20,21) |
| InChIKey | HAFXLWMEVCQSPR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|