C19H28N2O3 — CID 72786009
2-(2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 72786009) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is 2-(2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | 2-(2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 72786009 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2-(2-hydroxy-1-methoxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | COCC(O)(CCC(C)=C(C)C)C1Cc2cc(C(N)=O)ccc2N1 |
| InChI | InChI=1S/C19H28N2O3/c1-12(2)13(3)7-8-19(23,11-24-4)17-10-15-9-14(18(20)22)5-6-16(15)21-17/h5-6,9,17,21,23H,7-8,10-11H2,1-4H3,(H2,20,22) |
| InChIKey | OTZRBYNNRWOBRT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|