About (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol
(1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol (PubChem CID 72789571) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol.
Molecular Properties
| Compound Name | (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol |
| PubChem CID | 72789571 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol |
| SMILES | COC12C3C=CC1C2C(CO)C3 |
| InChI | InChI=1S/C10H14O2/c1-12-10-7-2-3-8(10)9(10)6(4-7)5-11/h2-3,6-9,11H,4-5H2,1H3 |
| InChIKey | JDGBCXMLMPSABJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol?
The IUPAC name of (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol (CID 72789571) is (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol.
What is the SMILES notation for (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol?
The canonical SMILES for (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol is COC12C3C=CC1C2C(CO)C3.
What is the InChIKey of (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol?
The InChIKey is JDGBCXMLMPSABJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2/c1-12-10-7-2-3-8(10)9(10)6(4-7)5-11/h2-3,6-9,11H,4-5H2,1H3.
What are the key properties of (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol?
(1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol has a molecular weight of 166.22 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methoxy-3-tricyclo[3.3.0.02,8]oct-6-enyl)methanol is sourced from PubChem (CID 72789571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).