C14H17NO5S — CID 72792531
4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-1,3-oxazolidine-2-thione (PubChem CID 72792531) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-1,3-oxazolidine-2-thione.
| Compound Name | 4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 72792531 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | 4-[(2R,3R,4R,5S)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-1,3-oxazolidine-2-thione |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@@H](C2COC(=S)N2)O[C@@H]1O |
| InChI | InChI=1S/C14H17NO5S/c16-10-12(18-6-8-4-2-1-3-5-8)11(20-13(10)17)9-7-19-14(21)15-9/h1-5,9-13,16-17H,6-7H2,(H,15,21)/t9?,10-,11-,12-,13+/m1/s1 |
| InChIKey | GOMLPFZBHJOOSZ-CBZUXLNKSA-N |
| XLogP | -0.08 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|