C25H36F2N6O — CID 72792562
4-[[2-(butylamino)-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 72792562) has the molecular formula C25H36F2N6O and a molecular weight of 474.60 g/mol. Its IUPAC name is 4-[[2-(butylamino)-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-(butylamino)-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72792562 |
| Molecular Formula | C25H36F2N6O |
| Molecular Weight | 474.60 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 4-[[2-(butylamino)-5-[5-[(4,4-difluoropiperidin-1-yl)methyl]-2-pyridinyl]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CCCCNc1ncc(-c2ccc(CN3CCC(F)(F)CC3)cn2)c(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C25H36F2N6O/c1-2-3-12-28-24-30-16-21(23(32-24)31-19-5-7-20(34)8-6-19)22-9-4-18(15-29-22)17-33-13-10-25(26,27)11-14-33/h4,9,15-16,19-20,34H,2-3,5-8,10-14,17H2,1H3,(H2,28,30,31,32) |
| InChIKey | NEZRLVDPFUFEKB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 86.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.60 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|