1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate

C11H13Br2NO5 — CID 72792679

IUPAC1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate
SMILESCCCCCC(O[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O
InChIInChI=1S/C11H13Br2NO5/c1-2-3-4-5-8(19-14(16)17)7-6-9(10(12)13)18-11(7)15/h6,8H,2-5H2,1H3
InChIKeyGHHBUVYQPJAFII-UHFFFAOYSA-N
MW399.04 g/mol
LogP3.59
Rot. Bonds7

About 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate

1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate (PubChem CID 72792679) has the molecular formula C11H13Br2NO5 and a molecular weight of 399.04 g/mol. Its IUPAC name is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate.

Molecular Properties

Compound Name1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate
PubChem CID72792679
Molecular FormulaC11H13Br2NO5
Molecular Weight399.04 g/mol
Exact Mass396.92
IUPAC Name1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate
SMILESCCCCCC(O[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O
InChIInChI=1S/C11H13Br2NO5/c1-2-3-4-5-8(19-14(16)17)7-6-9(10(12)13)18-11(7)15/h6,8H,2-5H2,1H3
InChIKeyGHHBUVYQPJAFII-UHFFFAOYSA-N
XLogP3.59
TPSA78.67 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500399.04
LogP ≤ 53.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate?
The IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate (CID 72792679) is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate.
What is the SMILES notation for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate?
The canonical SMILES for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate is CCCCCC(O[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O.
What is the InChIKey of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate?
The InChIKey is GHHBUVYQPJAFII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Br2NO5/c1-2-3-4-5-8(19-14(16)17)7-6-9(10(12)13)18-11(7)15/h6,8H,2-5H2,1H3.
What are the key properties of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate?
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate has a molecular weight of 399.04 g/mol, XLogP of 3.59, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]hexyl nitrate is sourced from PubChem (CID 72792679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).