C23H22N2O4 — CID 72792686
3,5-bis(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine (PubChem CID 72792686) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3,5-bis(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3,5-bis(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 72792686 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3,5-bis(3,4-dimethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine |
| SMILES | COc1ccc(-c2cnc3[nH]cc(-c4ccc(OC)c(OC)c4)c3c2)cc1OC |
| InChI | InChI=1S/C23H22N2O4/c1-26-19-7-5-14(10-21(19)28-3)16-9-17-18(13-25-23(17)24-12-16)15-6-8-20(27-2)22(11-15)29-4/h5-13H,1-4H3,(H,24,25) |
| InChIKey | BAQPWVGCKOCBIN-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 65.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |