About 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate (PubChem CID 72792752) has the molecular formula C13H15Br2NO7
and a molecular weight of 457.07 g/mol. Its IUPAC name is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate.
Molecular Properties
| Compound Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate |
| PubChem CID | 72792752 |
| Molecular Formula | C13H15Br2NO7 |
| Molecular Weight | 457.07 g/mol |
| Exact Mass | 454.92 |
| IUPAC Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate |
| SMILES | CCCC(OC(=O)CCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O |
| InChI | InChI=1S/C13H15Br2NO7/c1-2-4-9(8-7-10(12(14)15)23-13(8)18)22-11(17)5-3-6-21-16(19)20/h7,9H,2-6H2,1H3 |
| InChIKey | NRTPOPUBIXKIJN-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.07 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate?
The IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate (CID 72792752) is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate.
What is the SMILES notation for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate?
The canonical SMILES for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate is CCCC(OC(=O)CCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O.
What is the InChIKey of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate?
The InChIKey is NRTPOPUBIXKIJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Br2NO7/c1-2-4-9(8-7-10(12(14)15)23-13(8)18)22-11(17)5-3-6-21-16(19)20/h7,9H,2-6H2,1H3.
What are the key properties of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate?
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate has a molecular weight of 457.07 g/mol, XLogP of 3.13, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 4-nitrooxybutanoate is sourced from PubChem (CID 72792752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).