About 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate (PubChem CID 72792753) has the molecular formula C15H19Br2NO7
and a molecular weight of 485.13 g/mol. Its IUPAC name is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate.
Molecular Properties
| Compound Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate |
| PubChem CID | 72792753 |
| Molecular Formula | C15H19Br2NO7 |
| Molecular Weight | 485.13 g/mol |
| Exact Mass | 482.95 |
| IUPAC Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate |
| SMILES | CCCC(OC(=O)CCCCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O |
| InChI | InChI=1S/C15H19Br2NO7/c1-2-6-11(10-9-12(14(16)17)25-15(10)20)24-13(19)7-4-3-5-8-23-18(21)22/h9,11H,2-8H2,1H3 |
| InChIKey | IMSZNSOUGNMKNJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 485.13 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate?
The IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate (CID 72792753) is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate.
What is the SMILES notation for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate?
The canonical SMILES for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate is CCCC(OC(=O)CCCCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O.
What is the InChIKey of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate?
The InChIKey is IMSZNSOUGNMKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Br2NO7/c1-2-6-11(10-9-12(14(16)17)25-15(10)20)24-13(19)7-4-3-5-8-23-18(21)22/h9,11H,2-8H2,1H3.
What are the key properties of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate?
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate has a molecular weight of 485.13 g/mol, XLogP of 3.91, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 6-nitrooxyhexanoate is sourced from PubChem (CID 72792753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).