About 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate (PubChem CID 72792818) has the molecular formula C20H29Br2NO7
and a molecular weight of 555.26 g/mol. Its IUPAC name is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate.
Molecular Properties
| Compound Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate |
| PubChem CID | 72792818 |
| Molecular Formula | C20H29Br2NO7 |
| Molecular Weight | 555.26 g/mol |
| Exact Mass | 553.03 |
| IUPAC Name | 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate |
| SMILES | CCCC(OC(=O)CCCCCCCCCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O |
| InChI | InChI=1S/C20H29Br2NO7/c1-2-11-16(15-14-17(19(21)22)30-20(15)25)29-18(24)12-9-7-5-3-4-6-8-10-13-28-23(26)27/h14,16H,2-13H2,1H3 |
| InChIKey | XGERWDBNEILCBT-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 555.26 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate?
The IUPAC name of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate (CID 72792818) is 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate.
What is the SMILES notation for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate?
The canonical SMILES for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate is CCCC(OC(=O)CCCCCCCCCCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O.
What is the InChIKey of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate?
The InChIKey is XGERWDBNEILCBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29Br2NO7/c1-2-11-16(15-14-17(19(21)22)30-20(15)25)29-18(24)12-9-7-5-3-4-6-8-10-13-28-23(26)27/h14,16H,2-13H2,1H3.
What are the key properties of 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate?
1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate has a molecular weight of 555.26 g/mol, XLogP of 5.86, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl 11-nitrooxyundecanoate is sourced from PubChem (CID 72792818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).