About S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate
S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate (PubChem CID 72792819) has the molecular formula C12H13Br2NO6S
and a molecular weight of 459.11 g/mol. Its IUPAC name is S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate.
Molecular Properties
| Compound Name | S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate |
| PubChem CID | 72792819 |
| Molecular Formula | C12H13Br2NO6S |
| Molecular Weight | 459.11 g/mol |
| Exact Mass | 456.88 |
| IUPAC Name | S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate |
| SMILES | CCCC(SC(=O)CCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O |
| InChI | InChI=1S/C12H13Br2NO6S/c1-2-3-9(22-10(16)4-5-20-15(18)19)7-6-8(11(13)14)21-12(7)17/h6,9H,2-5H2,1H3 |
| InChIKey | KSJBLYPOUBNQEG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.11 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate?
The IUPAC name of S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate (CID 72792819) is S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate.
What is the SMILES notation for S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate?
The canonical SMILES for S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate is CCCC(SC(=O)CCO[N+](=O)[O-])C1=CC(=C(Br)Br)OC1=O.
What is the InChIKey of S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate?
The InChIKey is KSJBLYPOUBNQEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13Br2NO6S/c1-2-3-9(22-10(16)4-5-20-15(18)19)7-6-8(11(13)14)21-12(7)17/h6,9H,2-5H2,1H3.
What are the key properties of S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate?
S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate has a molecular weight of 459.11 g/mol, XLogP of 3.46, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for S-[1-[5-(dibromomethylidene)-2-oxofuran-3-yl]butyl] 3-nitrooxypropanethioate is sourced from PubChem (CID 72792819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).