C30H42N4O11S — CID 72792833
[(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl butanoate (PubChem CID 72792833) has the molecular formula C30H42N4O11S and a molecular weight of 666.75 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl butanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl butanoate |
|---|---|
| PubChem CID | 72792833 |
| Molecular Formula | C30H42N4O11S |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(butanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@H]1O[C@@H](n2cc(-c3ccc(S(N)(=O)=O)cc3)nn2)[C@H](OC(=O)CCC)[C@@H](OC(=O)CCC)[C@@H]1OC(=O)CCC |
| InChI | InChI=1S/C30H42N4O11S/c1-5-9-23(35)41-18-22-27(43-24(36)10-6-2)28(44-25(37)11-7-3)29(45-26(38)12-8-4)30(42-22)34-17-21(32-33-34)19-13-15-20(16-14-19)46(31,39)40/h13-17,22,27-30H,5-12,18H2,1-4H3,(H2,31,39,40)/t22-,27-,28+,29-,30-/m1/s1 |
| InChIKey | XDLCONKAGDFVRD-NRCRZUOTSA-N |
| XLogP | 2.97 |
| TPSA | 205.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|