C34H50N4O11S — CID 72792834
[(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl pentanoate (PubChem CID 72792834) has the molecular formula C34H50N4O11S and a molecular weight of 722.86 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl pentanoate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl pentanoate |
|---|---|
| PubChem CID | 72792834 |
| Molecular Formula | C34H50N4O11S |
| Molecular Weight | 722.86 g/mol |
| Exact Mass | 722.32 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-tri(pentanoyloxy)-6-[4-(4-sulfamoylphenyl)triazol-1-yl]oxan-2-yl]methyl pentanoate |
| SMILES | CCCCC(=O)OC[C@H]1O[C@@H](n2cc(-c3ccc(S(N)(=O)=O)cc3)nn2)[C@H](OC(=O)CCCC)[C@@H](OC(=O)CCCC)[C@@H]1OC(=O)CCCC |
| InChI | InChI=1S/C34H50N4O11S/c1-5-9-13-27(39)45-22-26-31(47-28(40)14-10-6-2)32(48-29(41)15-11-7-3)33(49-30(42)16-12-8-4)34(46-26)38-21-25(36-37-38)23-17-19-24(20-18-23)50(35,43)44/h17-21,26,31-34H,5-16,22H2,1-4H3,(H2,35,43,44)/t26-,31-,32+,33-,34-/m1/s1 |
| InChIKey | WJEBDIQNCFVULI-VQHOHFBQSA-N |
| XLogP | 4.53 |
| TPSA | 205.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.86 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|