C25H45IO3Si — CID 72793116
[(Z,2S)-2-(3,3-dimethyl-1,5-dioxaspiro[5.5]undec-9-en-9-yl)-5-iodo-6-methylhept-4-enoxy]-triethylsilane (PubChem CID 72793116) has the molecular formula C25H45IO3Si and a molecular weight of 548.62 g/mol. Its IUPAC name is [(Z,2S)-2-(3,3-dimethyl-1,5-dioxaspiro[5.5]undec-9-en-9-yl)-5-iodo-6-methylhept-4-enoxy]-triethylsilane.
| Compound Name | [(Z,2S)-2-(3,3-dimethyl-1,5-dioxaspiro[5.5]undec-9-en-9-yl)-5-iodo-6-methylhept-4-enoxy]-triethylsilane |
|---|---|
| PubChem CID | 72793116 |
| Molecular Formula | C25H45IO3Si |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | [(Z,2S)-2-(3,3-dimethyl-1,5-dioxaspiro[5.5]undec-9-en-9-yl)-5-iodo-6-methylhept-4-enoxy]-triethylsilane |
| SMILES | CC[Si](CC)(CC)OC[C@@H](C/C=C(\I)C(C)C)C1=CCC2(CC1)OCC(C)(C)CO2 |
| InChI | InChI=1S/C25H45IO3Si/c1-8-30(9-2,10-3)29-17-22(11-12-23(26)20(4)5)21-13-15-25(16-14-21)27-18-24(6,7)19-28-25/h12-13,20,22H,8-11,14-19H2,1-7H3/b23-12-/t22-/m1/s1 |
| InChIKey | MGMSOVFNPYDKEK-VPZZMXQWSA-N |
| XLogP | 7.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|