C14H18O — CID 72793122
2-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-pyran (PubChem CID 72793122) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-pyran.
| Compound Name | 2-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 72793122 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)-3,4-dihydro-2H-pyran |
| SMILES | Cc1cc(C)c(C2CCC=CO2)c(C)c1 |
| InChI | InChI=1S/C14H18O/c1-10-8-11(2)14(12(3)9-10)13-6-4-5-7-15-13/h5,7-9,13H,4,6H2,1-3H3 |
| InChIKey | RMBKUACDIXHZTA-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |