About 2-(dibromomethyl)-1,3-dihydroinden-2-ol
2-(dibromomethyl)-1,3-dihydroinden-2-ol (PubChem CID 72793193) has the molecular formula C10H10Br2O
and a molecular weight of 306.00 g/mol. Its IUPAC name is 2-(dibromomethyl)-1,3-dihydroinden-2-ol.
Molecular Properties
| Compound Name | 2-(dibromomethyl)-1,3-dihydroinden-2-ol |
| PubChem CID | 72793193 |
| Molecular Formula | C10H10Br2O |
| Molecular Weight | 306.00 g/mol |
| Exact Mass | 303.91 |
| IUPAC Name | 2-(dibromomethyl)-1,3-dihydroinden-2-ol |
| SMILES | OC1(C(Br)Br)Cc2ccccc2C1 |
| InChI | InChI=1S/C10H10Br2O/c11-9(12)10(13)5-7-3-1-2-4-8(7)6-10/h1-4,9,13H,5-6H2 |
| InChIKey | LSGJTXLWWANFHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.00 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(dibromomethyl)-1,3-dihydroinden-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibromomethyl)-1,3-dihydroinden-2-ol?
The IUPAC name of 2-(dibromomethyl)-1,3-dihydroinden-2-ol (CID 72793193) is 2-(dibromomethyl)-1,3-dihydroinden-2-ol.
What is the SMILES notation for 2-(dibromomethyl)-1,3-dihydroinden-2-ol?
The canonical SMILES for 2-(dibromomethyl)-1,3-dihydroinden-2-ol is OC1(C(Br)Br)Cc2ccccc2C1.
What is the InChIKey of 2-(dibromomethyl)-1,3-dihydroinden-2-ol?
The InChIKey is LSGJTXLWWANFHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2O/c11-9(12)10(13)5-7-3-1-2-4-8(7)6-10/h1-4,9,13H,5-6H2.
What are the key properties of 2-(dibromomethyl)-1,3-dihydroinden-2-ol?
2-(dibromomethyl)-1,3-dihydroinden-2-ol has a molecular weight of 306.00 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibromomethyl)-1,3-dihydroinden-2-ol is sourced from PubChem (CID 72793193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).