C27H24O2S — CID 72793224
(3'R,5'R)-3',5'-bis(4-methylphenyl)spiro[1-benzothiophene-3,4'-cyclohexane]-1',2-dione (PubChem CID 72793224) has the molecular formula C27H24O2S and a molecular weight of 412.55 g/mol. Its IUPAC name is (3'R,5'R)-3',5'-bis(4-methylphenyl)spiro[1-benzothiophene-3,4'-cyclohexane]-1',2-dione.
| Compound Name | (3'R,5'R)-3',5'-bis(4-methylphenyl)spiro[1-benzothiophene-3,4'-cyclohexane]-1',2-dione |
|---|---|
| PubChem CID | 72793224 |
| Molecular Formula | C27H24O2S |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (3'R,5'R)-3',5'-bis(4-methylphenyl)spiro[1-benzothiophene-3,4'-cyclohexane]-1',2-dione |
| SMILES | Cc1ccc([C@H]2CC(=O)C[C@H](c3ccc(C)cc3)C23C(=O)Sc2ccccc23)cc1 |
| InChI | InChI=1S/C27H24O2S/c1-17-7-11-19(12-8-17)23-15-21(28)16-24(20-13-9-18(2)10-14-20)27(23)22-5-3-4-6-25(22)30-26(27)29/h3-14,23-24H,15-16H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | QYUPVBBGHHPKRP-DNQXCXABSA-N |
| XLogP | 6.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|