C14H17NO6S — CID 72793567
4-[(2S,3R,4R,5R)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-4-hydroxy-1,3-oxazolidine-2-thione (PubChem CID 72793567) has the molecular formula C14H17NO6S and a molecular weight of 327.36 g/mol. Its IUPAC name is 4-[(2S,3R,4R,5R)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-4-hydroxy-1,3-oxazolidine-2-thione.
| Compound Name | 4-[(2S,3R,4R,5R)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-4-hydroxy-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 72793567 |
| Molecular Formula | C14H17NO6S |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-[(2S,3R,4R,5R)-4,5-dihydroxy-3-phenylmethoxyoxolan-2-yl]-4-hydroxy-1,3-oxazolidine-2-thione |
| SMILES | O[C@@H]1[C@@H](OCc2ccccc2)[C@@H](C2(O)COC(=S)N2)O[C@H]1O |
| InChI | InChI=1S/C14H17NO6S/c16-9-10(19-6-8-4-2-1-3-5-8)11(21-12(9)17)14(18)7-20-13(22)15-14/h1-5,9-12,16-18H,6-7H2,(H,15,22)/t9-,10-,11+,12-,14?/m1/s1 |
| InChIKey | BLJIGIKUIGINDC-GRJWACCOSA-N |
| XLogP | -0.76 |
| TPSA | 100.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|