C25H33F3N6O5S — CID 72793610
4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxamide (PubChem CID 72793610) has the molecular formula C25H33F3N6O5S and a molecular weight of 586.64 g/mol. Its IUPAC name is 4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxamide.
| Compound Name | 4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 72793610 |
| Molecular Formula | C25H33F3N6O5S |
| Molecular Weight | 586.64 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 4-[(4-hydroxycyclohexyl)amino]-N-(4-morpholin-4-ylsulfonylphenyl)-2-(4,4,4-trifluorobutylamino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cnc(NCCCC(F)(F)F)nc1NC1CCC(O)CC1 |
| InChI | InChI=1S/C25H33F3N6O5S/c26-25(27,28)10-1-11-29-24-30-16-21(22(33-24)31-17-2-6-19(35)7-3-17)23(36)32-18-4-8-20(9-5-18)40(37,38)34-12-14-39-15-13-34/h4-5,8-9,16-17,19,35H,1-3,6-7,10-15H2,(H,32,36)(H2,29,30,31,33) |
| InChIKey | WHWWZWPSOQJMQR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 145.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|