C26H34N4O — CID 72793621
4-tert-butyl-N-[2-cyclohexyl-6-(dimethylamino)-3H-benzimidazol-5-yl]benzamide (PubChem CID 72793621) has the molecular formula C26H34N4O and a molecular weight of 418.59 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-cyclohexyl-6-(dimethylamino)-3H-benzimidazol-5-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-cyclohexyl-6-(dimethylamino)-3H-benzimidazol-5-yl]benzamide |
|---|---|
| PubChem CID | 72793621 |
| Molecular Formula | C26H34N4O |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | 4-tert-butyl-N-[2-cyclohexyl-6-(dimethylamino)-3H-benzimidazol-5-yl]benzamide |
| SMILES | CN(C)c1cc2nc(C3CCCCC3)[nH]c2cc1NC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C26H34N4O/c1-26(2,3)19-13-11-18(12-14-19)25(31)29-22-15-20-21(16-23(22)30(4)5)28-24(27-20)17-9-7-6-8-10-17/h11-17H,6-10H2,1-5H3,(H,27,28)(H,29,31) |
| InChIKey | WHJOZFIBAJLGLQ-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |