C32H46I2N3PS — CID 72793653
tributyl-[3-[(4E)-4-[(4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl]phosphanium diiodide (PubChem CID 72793653) has the molecular formula C32H46I2N3PS and a molecular weight of 789.59 g/mol. Its IUPAC name is tributyl-[3-[(4E)-4-[(4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl]phosphanium diiodide.
| Compound Name | tributyl-[3-[(4E)-4-[(4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl]phosphanium diiodide |
|---|---|
| PubChem CID | 72793653 |
| Molecular Formula | C32H46I2N3PS |
| Molecular Weight | 789.59 g/mol |
| Exact Mass | 789.12 |
| IUPAC Name | tributyl-[3-[(4E)-4-[(4-methyl-[1,3]thiazolo[4,5-b]pyridin-4-ium-2-yl)methylidene]quinolin-1-yl]propyl]phosphanium diiodide |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCN1C=C/C(=C\c2nc3c(ccc[n+]3C)s2)c2ccccc21.[I-].[I-] |
| InChI | InChI=1S/C32H46N3PS.2HI/c1-5-8-22-36(23-9-6-2,24-10-7-3)25-14-20-35-21-18-27(28-15-11-12-16-29(28)35)26-31-33-32-30(37-31)17-13-19-34(32)4;;/h11-13,15-19,21,26H,5-10,14,20,22-25H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | DJIWDNBZTUEQHC-UHFFFAOYSA-L |
| XLogP | 2.81 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|